C26H44O7S — CID 88809022
2-[3-[(E)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]acetaldehyde (PubChem CID 88809022) has the molecular formula C26H44O7S and a molecular weight of 500.70 g/mol. Its IUPAC name is 2-[3-[(E)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]acetaldehyde.
| Compound Name | 2-[3-[(E)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 88809022 |
| Molecular Formula | C26H44O7S |
| Molecular Weight | 500.70 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 2-[3-[(E)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-4-(oxan-2-yloxy)-1,1-dioxothiolan-2-yl]acetaldehyde |
| SMILES | CCCCC(C)(C)C(/C=C/C1C(OC2CCCCO2)CS(=O)(=O)C1CC=O)OC1CCCCO1 |
| InChI | InChI=1S/C26H44O7S/c1-4-5-15-26(2,3)23(33-25-11-7-9-18-31-25)13-12-20-21(32-24-10-6-8-17-30-24)19-34(28,29)22(20)14-16-27/h12-13,16,20-25H,4-11,14-15,17-19H2,1-3H3/b13-12+ |
| InChIKey | AXNYFWOWNCUDLO-OUKQBFOZSA-N |
| XLogP | 4.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|