C33H54FIO7 — CID 70435038
methyl 5-[(3R,3aR,4R,5R,6aS)-4-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate (PubChem CID 70435038) has the molecular formula C33H54FIO7 and a molecular weight of 708.69 g/mol. Its IUPAC name is methyl 5-[(3R,3aR,4R,5R,6aS)-4-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate.
| Compound Name | methyl 5-[(3R,3aR,4R,5R,6aS)-4-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
|---|---|
| PubChem CID | 70435038 |
| Molecular Formula | C33H54FIO7 |
| Molecular Weight | 708.69 g/mol |
| Exact Mass | 708.29 |
| IUPAC Name | methyl 5-[(3R,3aR,4R,5R,6aS)-4-[(E,3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
| SMILES | CCCCC(C)(C)[C@@H](/C=C/[C@@H]1[C@@H]2[C@H](C[C@H]1OC1CCCCO1)OC(C(I)CCCC(=O)OC)[C@@H]2F)OC1CCCCO1 |
| InChI | InChI=1S/C33H54FIO7/c1-5-6-18-33(2,3)26(42-29-15-8-10-20-39-29)17-16-22-24(40-28-14-7-9-19-38-28)21-25-30(22)31(34)32(41-25)23(35)12-11-13-27(36)37-4/h16-17,22-26,28-32H,5-15,18-21H2,1-4H3/b17-16+/t22-,23?,24+,25-,26+,28?,29?,30+,31+,32?/m0/s1 |
| InChIKey | XVEKPQMZFGXINO-ZLZZRERZSA-N |
| XLogP | 7.47 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.69 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|