C29H48FIO5 — CID 70435151
methyl 5-[(3aR,4R,5R,6aS)-4-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate (PubChem CID 70435151) has the molecular formula C29H48FIO5 and a molecular weight of 622.60 g/mol. Its IUPAC name is methyl 5-[(3aR,4R,5R,6aS)-4-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate.
| Compound Name | methyl 5-[(3aR,4R,5R,6aS)-4-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
|---|---|
| PubChem CID | 70435151 |
| Molecular Formula | C29H48FIO5 |
| Molecular Weight | 622.60 g/mol |
| Exact Mass | 622.25 |
| IUPAC Name | methyl 5-[(3aR,4R,5R,6aS)-4-[(3R)-4,4-dimethyl-3-(oxan-2-yloxy)oct-1-enyl]-3-fluoro-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-yl]-5-iodopentanoate |
| SMILES | CCCCC(C)(C)[C@@H](C=C[C@@H]1[C@H]2C(F)C(C(I)CCCC(=O)OC)O[C@H]2C[C@H]1C)OC1CCCCO1 |
| InChI | InChI=1S/C29H48FIO5/c1-6-7-16-29(3,4)23(36-25-13-8-9-17-34-25)15-14-20-19(2)18-22-26(20)27(30)28(35-22)21(31)11-10-12-24(32)33-5/h14-15,19-23,25-28H,6-13,16-18H2,1-5H3/t19-,20+,21?,22+,23-,25?,26-,27?,28?/m1/s1 |
| InChIKey | QUJYABJZBXDVPK-HCDJRCPYSA-N |
| XLogP | 7.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|