C31H49F3O7 — CID 70487915
methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-7-fluorohept-5-enoate (PubChem CID 70487915) has the molecular formula C31H49F3O7 and a molecular weight of 590.72 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-7-fluorohept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-7-fluorohept-5-enoate |
|---|---|
| PubChem CID | 70487915 |
| Molecular Formula | C31H49F3O7 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4,4-difluoro-3-(oxan-2-yloxy)oct-1-enyl]-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-7-fluorohept-5-enoate |
| SMILES | CCCCC(F)(F)[C@@H](/C=C/[C@@H]1[C@@H](C(F)/C=C\CCCC(=O)OC)[C@@H](O)C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C31H49F3O7/c1-3-4-18-31(33,34)26(41-29-15-9-11-20-39-29)17-16-22-25(40-28-14-8-10-19-38-28)21-24(35)30(22)23(32)12-6-5-7-13-27(36)37-2/h6,12,16-17,22-26,28-30,35H,3-5,7-11,13-15,18-21H2,1-2H3/b12-6-,17-16+/t22-,23?,24-,25+,26+,28?,29?,30-/m0/s1 |
| InChIKey | MOQQVSYKEDTDRT-PHYSYWOGSA-N |
| XLogP | 6.43 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|