C26H43FO5 — CID 70488382
methyl (Z)-7-fluoro-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 70488382) has the molecular formula C26H43FO5 and a molecular weight of 454.62 g/mol. Its IUPAC name is methyl (Z)-7-fluoro-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-fluoro-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70488382 |
| Molecular Formula | C26H43FO5 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | methyl (Z)-7-fluoro-7-[(1R,2S,5R)-2-hydroxy-5-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@@H](/C=C/[C@H]1CC[C@H](O)[C@@H]1C(F)/C=C\CCCC(=O)OC)OC1CCCCO1 |
| InChI | InChI=1S/C26H43FO5/c1-3-4-6-11-21(32-25-14-9-10-19-31-25)17-15-20-16-18-23(28)26(20)22(27)12-7-5-8-13-24(29)30-2/h7,12,15,17,20-23,25-26,28H,3-6,8-11,13-14,16,18-19H2,1-2H3/b12-7-,17-15+/t20-,21-,22?,23-,25?,26-/m0/s1 |
| InChIKey | KMJIPQMXVAQLFX-GTYBKWDNSA-N |
| XLogP | 5.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|