C28H42O9 — CID 70615466
cis-(3S,5R)-1-(7-methoxy-7-oxohept-2-enyl)-5-[3-(oxan-2-yloxy)oct-1-enyl]-2-oxocyclopentane-1,3-dicarboxylic acid (PubChem CID 70615466) has the molecular formula C28H42O9 and a molecular weight of 522.64 g/mol. Its IUPAC name is cis-(3S,5R)-1-(7-methoxy-7-oxohept-2-enyl)-5-[3-(oxan-2-yloxy)oct-1-enyl]-2-oxocyclopentane-1,3-dicarboxylic acid.
| Compound Name | cis-(3S,5R)-1-(7-methoxy-7-oxohept-2-enyl)-5-[3-(oxan-2-yloxy)oct-1-enyl]-2-oxocyclopentane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 70615466 |
| Molecular Formula | C28H42O9 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | cis-(3S,5R)-1-(7-methoxy-7-oxohept-2-enyl)-5-[3-(oxan-2-yloxy)oct-1-enyl]-2-oxocyclopentane-1,3-dicarboxylic acid |
| SMILES | CCCCCC(C=C[C@H]1C[C@H](C(=O)O)C(=O)C1(CC=CCCCC(=O)OC)C(=O)O)OC1CCCCO1 |
| InChI | InChI=1S/C28H42O9/c1-3-4-7-12-21(37-24-14-9-11-18-36-24)16-15-20-19-22(26(31)32)25(30)28(20,27(33)34)17-10-6-5-8-13-23(29)35-2/h6,10,15-16,20-22,24H,3-5,7-9,11-14,17-19H2,1-2H3,(H,31,32)(H,33,34)/t20-,21?,22-,24?,28?/m0/s1 |
| InChIKey | QRCWAANLHQFBLS-POOHFMOFSA-N |
| XLogP | 4.69 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|