C25H38O8 — CID 70603726
trans-dimethyl (3S,5S)-5-(3-hydroxyoct-1-enyl)-1-(7-methoxy-7-oxohept-2-enyl)-2-oxocyclopentane-1,3-dicarboxylate (PubChem CID 70603726) has the molecular formula C25H38O8 and a molecular weight of 466.57 g/mol. Its IUPAC name is trans-dimethyl (3S,5S)-5-(3-hydroxyoct-1-enyl)-1-(7-methoxy-7-oxohept-2-enyl)-2-oxocyclopentane-1,3-dicarboxylate.
| Compound Name | trans-dimethyl (3S,5S)-5-(3-hydroxyoct-1-enyl)-1-(7-methoxy-7-oxohept-2-enyl)-2-oxocyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 70603726 |
| Molecular Formula | C25H38O8 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | trans-dimethyl (3S,5S)-5-(3-hydroxyoct-1-enyl)-1-(7-methoxy-7-oxohept-2-enyl)-2-oxocyclopentane-1,3-dicarboxylate |
| SMILES | CCCCCC(O)C=C[C@@H]1C[C@H](C(=O)OC)C(=O)C1(CC=CCCCC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C25H38O8/c1-5-6-9-12-19(26)15-14-18-17-20(23(29)32-3)22(28)25(18,24(30)33-4)16-11-8-7-10-13-21(27)31-2/h8,11,14-15,18-20,26H,5-7,9-10,12-13,16-17H2,1-4H3/t18-,19?,20+,25?/m1/s1 |
| InChIKey | JBZSTKILVYNIJQ-WKRUFEFESA-N |
| XLogP | 3.31 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|