C22H36O3S — CID 91064266
methyl 7-[(4S)-3-[(3S)-3-hydroxyoct-1-enyl]-2-thiabicyclo[3.1.1]heptan-4-yl]hept-5-enoate (PubChem CID 91064266) has the molecular formula C22H36O3S and a molecular weight of 380.59 g/mol. Its IUPAC name is methyl 7-[(4S)-3-[(3S)-3-hydroxyoct-1-enyl]-2-thiabicyclo[3.1.1]heptan-4-yl]hept-5-enoate.
| Compound Name | methyl 7-[(4S)-3-[(3S)-3-hydroxyoct-1-enyl]-2-thiabicyclo[3.1.1]heptan-4-yl]hept-5-enoate |
|---|---|
| PubChem CID | 91064266 |
| Molecular Formula | C22H36O3S |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | methyl 7-[(4S)-3-[(3S)-3-hydroxyoct-1-enyl]-2-thiabicyclo[3.1.1]heptan-4-yl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)C=CC1SC2CC(C2)[C@@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C22H36O3S/c1-3-4-7-10-18(23)13-14-21-20(17-15-19(16-17)26-21)11-8-5-6-9-12-22(24)25-2/h5,8,13-14,17-21,23H,3-4,6-7,9-12,15-16H2,1-2H3/t17?,18-,19?,20-,21?/m0/s1 |
| InChIKey | CCWLYMYUCHGIDU-ATSKTCODSA-N |
| XLogP | 5.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|