C23H40O3S2 — CID 159316742
(Z)-7-[(2R,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-6-thiabicyclo[3.1.1]heptan-2-yl]hept-5-enoic acid;tritiosulfanylethane (PubChem CID 159316742) has the molecular formula C23H40O3S2 and a molecular weight of 430.71 g/mol. Its IUPAC name is (Z)-7-[(2R,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-6-thiabicyclo[3.1.1]heptan-2-yl]hept-5-enoic acid;tritiosulfanylethane.
| Compound Name | (Z)-7-[(2R,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-6-thiabicyclo[3.1.1]heptan-2-yl]hept-5-enoic acid;tritiosulfanylethane |
|---|---|
| PubChem CID | 159316742 |
| Molecular Formula | C23H40O3S2 |
| Molecular Weight | 430.71 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (Z)-7-[(2R,3R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-6-thiabicyclo[3.1.1]heptan-2-yl]hept-5-enoic acid;tritiosulfanylethane |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1CC2CC(S2)[C@@H]1C/C=C\CCCC(=O)O.[3H]SCC |
| InChI | InChI=1S/C21H34O3S.C2H6S/c1-2-3-6-9-17(22)13-12-16-14-18-15-20(25-18)19(16)10-7-4-5-8-11-21(23)24;1-2-3/h4,7,12-13,16-20,22H,2-3,5-6,8-11,14-15H2,1H3,(H,23,24);3H,2H2,1H3/b7-4-,13-12+;/t16-,17-,18?,19+,20?;/m0./s1/i/hT |
| InChIKey | LDFSIQOGHJHSOE-WNFQVYEDSA-N |
| XLogP | 6.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.71 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|