C20H32O3S2 — CID 59915114
(Z)-7-[(1R,4S,5R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2,6-dithiabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid (PubChem CID 59915114) has the molecular formula C20H32O3S2 and a molecular weight of 384.61 g/mol. Its IUPAC name is (Z)-7-[(1R,4S,5R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2,6-dithiabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,4S,5R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2,6-dithiabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59915114 |
| Molecular Formula | C20H32O3S2 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (Z)-7-[(1R,4S,5R)-3-[(E,3S)-3-hydroxyoct-1-enyl]-2,6-dithiabicyclo[3.1.1]heptan-4-yl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](O)/C=C/C1S[C@@H]2C[C@@H](S2)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O3S2/c1-2-3-6-9-15(21)12-13-17-16(18-14-20(24-17)25-18)10-7-4-5-8-11-19(22)23/h4,7,12-13,15-18,20-21H,2-3,5-6,8-11,14H2,1H3,(H,22,23)/b7-4-,13-12+/t15-,16+,17?,18+,20-/m0/s1 |
| InChIKey | VQUANPGKQABZIH-JTHVFWSYSA-N |
| XLogP | 5.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|