C30H44O5 — CID 14582854
methyl 5-[2-[(1E,3E)-5-(oxan-2-yloxy)trideca-1,3-dienyl]phenyl]-5-oxopentanoate (PubChem CID 14582854) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is methyl 5-[2-[(1E,3E)-5-(oxan-2-yloxy)trideca-1,3-dienyl]phenyl]-5-oxopentanoate.
| Compound Name | methyl 5-[2-[(1E,3E)-5-(oxan-2-yloxy)trideca-1,3-dienyl]phenyl]-5-oxopentanoate |
|---|---|
| PubChem CID | 14582854 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | methyl 5-[2-[(1E,3E)-5-(oxan-2-yloxy)trideca-1,3-dienyl]phenyl]-5-oxopentanoate |
| SMILES | CCCCCCCCC(/C=C/C=C/c1ccccc1C(=O)CCCC(=O)OC)OC1CCCCO1 |
| InChI | InChI=1S/C30H44O5/c1-3-4-5-6-7-8-18-26(35-30-23-13-14-24-34-30)19-11-9-16-25-17-10-12-20-27(25)28(31)21-15-22-29(32)33-2/h9-12,16-17,19-20,26,30H,3-8,13-15,18,21-24H2,1-2H3/b16-9+,19-11+ |
| InChIKey | UNCYXOKIUYSAIT-HVWAQGSWSA-N |
| XLogP | 7.44 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|