C28H44O4 — CID 70623069
methyl (Z)-7-[(1R,4R)-3-[3-(oxan-2-yloxy)oct-1-enyl]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoate (PubChem CID 70623069) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,4R)-3-[3-(oxan-2-yloxy)oct-1-enyl]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,4R)-3-[3-(oxan-2-yloxy)oct-1-enyl]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoate |
|---|---|
| PubChem CID | 70623069 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | methyl (Z)-7-[(1R,4R)-3-[3-(oxan-2-yloxy)oct-1-enyl]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoate |
| SMILES | CCCCCC(C=CC1C(C/C=C\CCCC(=O)OC)[C@H]2C=C[C@H]1C2)OC1CCCCO1 |
| InChI | InChI=1S/C28H44O4/c1-3-4-7-12-24(32-28-15-10-11-20-31-28)18-19-26-23-17-16-22(21-23)25(26)13-8-5-6-9-14-27(29)30-2/h5,8,16-19,22-26,28H,3-4,6-7,9-15,20-21H2,1-2H3/b8-5-,19-18?/t22-,23-,24?,25?,26?,28?/m0/s1 |
| InChIKey | ZTPJWRNUAHQLHO-WOAKJJKBSA-N |
| XLogP | 6.76 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|