C32H50O6 — CID 54497343
methyl 5-[(3aR,5R,6S,6aS)-5-(oxan-2-yloxy)-6-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoate (PubChem CID 54497343) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is methyl 5-[(3aR,5R,6S,6aS)-5-(oxan-2-yloxy)-6-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoate.
| Compound Name | methyl 5-[(3aR,5R,6S,6aS)-5-(oxan-2-yloxy)-6-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoate |
|---|---|
| PubChem CID | 54497343 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | methyl 5-[(3aR,5R,6S,6aS)-5-(oxan-2-yloxy)-6-[(3S)-3-(oxan-2-yloxy)oct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pent-4-enoate |
| SMILES | CCCCC[C@@H](C=C[C@H]1[C@H]2CC(C=CCCC(=O)OC)=C[C@@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C32H50O6/c1-3-4-5-13-26(37-31-15-8-10-19-35-31)17-18-27-28-22-24(12-6-7-14-30(33)34-2)21-25(28)23-29(27)38-32-16-9-11-20-36-32/h6,12,17-18,21,25-29,31-32H,3-5,7-11,13-16,19-20,22-23H2,1-2H3/t25-,26+,27+,28+,29-,31?,32?/m1/s1 |
| InChIKey | YAAXKOWMMARMBC-ARPRCWAFSA-N |
| XLogP | 7.04 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|