C30H42O5 — CID 57106517
methyl 5-[(1S,2R,3aR,7aS)-1-(4-methyl-3-oxonon-1-en-6-ynyl)-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-5-yl]pent-4-enoate (PubChem CID 57106517) has the molecular formula C30H42O5 and a molecular weight of 482.66 g/mol. Its IUPAC name is methyl 5-[(1S,2R,3aR,7aS)-1-(4-methyl-3-oxonon-1-en-6-ynyl)-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-5-yl]pent-4-enoate.
| Compound Name | methyl 5-[(1S,2R,3aR,7aS)-1-(4-methyl-3-oxonon-1-en-6-ynyl)-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-5-yl]pent-4-enoate |
|---|---|
| PubChem CID | 57106517 |
| Molecular Formula | C30H42O5 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | methyl 5-[(1S,2R,3aR,7aS)-1-(4-methyl-3-oxonon-1-en-6-ynyl)-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-5-yl]pent-4-enoate |
| SMILES | CCC#CCC(C)C(=O)C=C[C@H]1[C@H]2CCC(C=CCCC(=O)OC)=C[C@@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C30H42O5/c1-4-5-6-11-22(2)27(31)18-17-26-25-16-15-23(12-7-8-13-29(32)33-3)20-24(25)21-28(26)35-30-14-9-10-19-34-30/h7,12,17-18,20,22,24-26,28,30H,4,8-11,13-16,19,21H2,1-3H3/t22?,24-,25+,26+,28-,30?/m1/s1 |
| InChIKey | HELDYTOKWRNMDJ-MVKFKSHWSA-N |
| XLogP | 5.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|