C28H42O5 — CID 67770222
methyl 5-[(3aR,5R,6R,6aR)-6-(1-hydroxy-4-methyloct-1-en-6-ynyl)-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (PubChem CID 67770222) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is methyl 5-[(3aR,5R,6R,6aR)-6-(1-hydroxy-4-methyloct-1-en-6-ynyl)-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aR,5R,6R,6aR)-6-(1-hydroxy-4-methyloct-1-en-6-ynyl)-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 67770222 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | methyl 5-[(3aR,5R,6R,6aR)-6-(1-hydroxy-4-methyloct-1-en-6-ynyl)-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| SMILES | CC#CCC(C)CC=C(O)[C@@H]1[C@@H]2CC(CCCCC(=O)OC)=C[C@@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C28H42O5/c1-4-5-10-20(2)14-15-24(29)28-23-18-21(11-6-7-12-26(30)31-3)17-22(23)19-25(28)33-27-13-8-9-16-32-27/h15,17,20,22-23,25,27-29H,6-14,16,18-19H2,1-3H3/t20?,22-,23-,25-,27?,28+/m1/s1 |
| InChIKey | OPBRUSNNRHOCNL-KDUOJAOGSA-N |
| XLogP | 6.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|