C27H43FO5 — CID 18648699
methyl 5-[(3aS,5R,6R,6aS)-6-(4-fluoro-3-oxooctyl)-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate (PubChem CID 18648699) has the molecular formula C27H43FO5 and a molecular weight of 466.63 g/mol. Its IUPAC name is methyl 5-[(3aS,5R,6R,6aS)-6-(4-fluoro-3-oxooctyl)-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate.
| Compound Name | methyl 5-[(3aS,5R,6R,6aS)-6-(4-fluoro-3-oxooctyl)-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
|---|---|
| PubChem CID | 18648699 |
| Molecular Formula | C27H43FO5 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | methyl 5-[(3aS,5R,6R,6aS)-6-(4-fluoro-3-oxooctyl)-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoate |
| SMILES | CCCCC(F)C(=O)CC[C@@H]1[C@H]2CC(CCCCC(=O)OC)=C[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C27H43FO5/c1-3-4-10-23(28)24(29)14-13-21-22-17-19(9-5-6-11-26(30)31-2)16-20(22)18-25(21)33-27-12-7-8-15-32-27/h16,20-23,25,27H,3-15,17-18H2,1-2H3/t20-,21+,22-,23?,25+,27?/m0/s1 |
| InChIKey | WTSDRDDGEMWEKM-YOFLFJLGSA-N |
| XLogP | 6.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|