C25H48O7Si — CID 123263619
methyl 7-[2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-5-hydroxyheptanoate (PubChem CID 123263619) has the molecular formula C25H48O7Si and a molecular weight of 488.74 g/mol. Its IUPAC name is methyl 7-[2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-5-hydroxyheptanoate.
| Compound Name | methyl 7-[2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-5-hydroxyheptanoate |
|---|---|
| PubChem CID | 123263619 |
| Molecular Formula | C25H48O7Si |
| Molecular Weight | 488.74 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | methyl 7-[2-(2-tert-butylsilyloxypropan-2-yl)-5-hydroxy-3-(oxan-2-yloxy)cyclopentyl]-5-hydroxyheptanoate |
| SMILES | COC(=O)CCCC(O)CCC1C(O)CC(OC2CCCCO2)C1C(C)(C)O[SiH2]C(C)(C)C |
| InChI | InChI=1S/C25H48O7Si/c1-24(2,3)33-32-25(4,5)23-18(14-13-17(26)10-9-11-21(28)29-6)19(27)16-20(23)31-22-12-7-8-15-30-22/h17-20,22-23,26-27H,7-16,33H2,1-6H3 |
| InChIKey | QUGQOKFILFLNDA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|