C26H46O7Si — CID 173366023
[3-(2-tert-butylsilyloxypropan-2-yl)-4-(oxan-2-yloxy)-2-[2-(6-oxooxan-2-yl)ethyl]cyclopentyl] acetate (PubChem CID 173366023) has the molecular formula C26H46O7Si and a molecular weight of 498.73 g/mol. Its IUPAC name is [3-(2-tert-butylsilyloxypropan-2-yl)-4-(oxan-2-yloxy)-2-[2-(6-oxooxan-2-yl)ethyl]cyclopentyl] acetate.
| Compound Name | [3-(2-tert-butylsilyloxypropan-2-yl)-4-(oxan-2-yloxy)-2-[2-(6-oxooxan-2-yl)ethyl]cyclopentyl] acetate |
|---|---|
| PubChem CID | 173366023 |
| Molecular Formula | C26H46O7Si |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [3-(2-tert-butylsilyloxypropan-2-yl)-4-(oxan-2-yloxy)-2-[2-(6-oxooxan-2-yl)ethyl]cyclopentyl] acetate |
| SMILES | CC(=O)OC1CC(OC2CCCCO2)C(C(C)(C)O[SiH2]C(C)(C)C)C1CCC1CCCC(=O)O1 |
| InChI | InChI=1S/C26H46O7Si/c1-17(27)30-20-16-21(32-23-12-7-8-15-29-23)24(26(5,6)33-34-25(2,3)4)19(20)14-13-18-10-9-11-22(28)31-18/h18-21,23-24H,7-16,34H2,1-6H3 |
| InChIKey | CUDJUSOCQPVNIO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|