C26H48O6Si — CID 123218162
2-[(1S,2R,3R,5S)-5-tert-butylsilyloxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde (PubChem CID 123218162) has the molecular formula C26H48O6Si and a molecular weight of 484.75 g/mol. Its IUPAC name is 2-[(1S,2R,3R,5S)-5-tert-butylsilyloxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde.
| Compound Name | 2-[(1S,2R,3R,5S)-5-tert-butylsilyloxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde |
|---|---|
| PubChem CID | 123218162 |
| Molecular Formula | C26H48O6Si |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | 2-[(1S,2R,3R,5S)-5-tert-butylsilyloxy-3-(oxan-2-yloxy)-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]acetaldehyde |
| SMILES | CCCCCC1(CC[C@@H]2[C@H](CC=O)[C@@H](O[SiH2]C(C)(C)C)C[C@H]2OC2CCCCO2)OCCO1 |
| InChI | InChI=1S/C26H48O6Si/c1-5-6-8-13-26(29-17-18-30-26)14-11-20-21(12-15-27)23(32-33-25(2,3)4)19-22(20)31-24-10-7-9-16-28-24/h15,20-24H,5-14,16-19,33H2,1-4H3/t20-,21+,22-,23+,24?/m1/s1 |
| InChIKey | AKZHBTUOYANVNO-NIVHGDGRSA-N |
| XLogP | 4.91 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|