C32H50O6 — CID 57102126
5-[(3aR,5R,6R,6aR)-6-[4-cyclopentyl-1-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid (PubChem CID 57102126) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is 5-[(3aR,5R,6R,6aR)-6-[4-cyclopentyl-1-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid.
| Compound Name | 5-[(3aR,5R,6R,6aR)-6-[4-cyclopentyl-1-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57102126 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | 5-[(3aR,5R,6R,6aR)-6-[4-cyclopentyl-1-(oxan-2-yloxy)but-1-enyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCC1=C[C@@H]2C[C@@H](OC3CCCCO3)[C@H](C(=CCCC3CCCC3)OC3CCCCO3)[C@@H]2C1 |
| InChI | InChI=1S/C32H50O6/c33-29(34)15-4-3-12-24-20-25-22-28(38-31-17-6-8-19-36-31)32(26(25)21-24)27(37-30-16-5-7-18-35-30)14-9-13-23-10-1-2-11-23/h14,20,23,25-26,28,30-32H,1-13,15-19,21-22H2,(H,33,34)/t25-,26-,28-,30?,31?,32+/m1/s1 |
| InChIKey | WAGOZMPENHTARN-RJXLRDKFSA-N |
| XLogP | 7.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|