C34H54O6S — CID 57111142
2-[2-[(3aR,5R,6R,6aR)-6-[(5R)-5,9-dimethyl-1-(oxan-2-yloxy)deca-1,8-dienyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylsulfanyl]acetic acid (PubChem CID 57111142) has the molecular formula C34H54O6S and a molecular weight of 590.87 g/mol. Its IUPAC name is 2-[2-[(3aR,5R,6R,6aR)-6-[(5R)-5,9-dimethyl-1-(oxan-2-yloxy)deca-1,8-dienyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(3aR,5R,6R,6aR)-6-[(5R)-5,9-dimethyl-1-(oxan-2-yloxy)deca-1,8-dienyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 57111142 |
| Molecular Formula | C34H54O6S |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | 2-[2-[(3aR,5R,6R,6aR)-6-[(5R)-5,9-dimethyl-1-(oxan-2-yloxy)deca-1,8-dienyl]-5-(oxan-2-yloxy)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]ethylsulfanyl]acetic acid |
| SMILES | CC(C)=CCC[C@@H](C)CCC=C(OC1CCCCO1)[C@@H]1[C@@H]2CC(CCSCC(=O)O)=C[C@@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C34H54O6S/c1-24(2)10-8-11-25(3)12-9-13-29(39-32-14-4-6-17-37-32)34-28-21-26(16-19-41-23-31(35)36)20-27(28)22-30(34)40-33-15-5-7-18-38-33/h10,13,20,25,27-28,30,32-34H,4-9,11-12,14-19,21-23H2,1-3H3,(H,35,36)/t25-,27-,28-,30-,32?,33?,34+/m1/s1 |
| InChIKey | GLSZUPAWAYZVMP-KIZHQVKXSA-N |
| XLogP | 8.28 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|