C26H40O7 — CID 70489632
2-[(2R,3R)-2-[(E)-4-methyl-1-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentylidene]acetic acid (PubChem CID 70489632) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is 2-[(2R,3R)-2-[(E)-4-methyl-1-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentylidene]acetic acid.
| Compound Name | 2-[(2R,3R)-2-[(E)-4-methyl-1-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentylidene]acetic acid |
|---|---|
| PubChem CID | 70489632 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 2-[(2R,3R)-2-[(E)-4-methyl-1-(oxan-2-yloxy)oct-1-enyl]-3-(oxan-2-yloxy)-5-oxocyclopentylidene]acetic acid |
| SMILES | CCCCC(C)C/C=C(/OC1CCCCO1)[C@@H]1C(=CC(=O)O)C(=O)C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C26H40O7/c1-3-4-9-18(2)12-13-21(32-24-10-5-7-14-30-24)26-19(16-23(28)29)20(27)17-22(26)33-25-11-6-8-15-31-25/h13,16,18,22,24-26H,3-12,14-15,17H2,1-2H3,(H,28,29)/b19-16?,21-13+/t18?,22-,24?,25?,26+/m1/s1 |
| InChIKey | SCFIVRAQJZUHCX-ZIXBRKPVSA-N |
| XLogP | 5.14 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|