C21H33FO4 — CID 57024148
3a-[(4R)-4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 57024148) has the molecular formula C21H33FO4 and a molecular weight of 368.49 g/mol. Its IUPAC name is 3a-[(4R)-4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | 3a-[(4R)-4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 57024148 |
| Molecular Formula | C21H33FO4 |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 3a-[(4R)-4-fluoro-1-(oxan-2-yloxy)oct-1-enyl]-6a-methyl-3,4,5,6-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | CCCC[C@@H](F)CC=C(OC1CCCCO1)C12CCCC1(C)OC(=O)C2 |
| InChI | InChI=1S/C21H33FO4/c1-3-4-8-16(22)10-11-17(25-19-9-5-6-14-24-19)21-13-7-12-20(21,2)26-18(23)15-21/h11,16,19H,3-10,12-15H2,1-2H3/t16-,19?,20?,21?/m1/s1 |
| InChIKey | MTQOJLZPZRMDHH-SJFWKDOISA-N |
| XLogP | 5.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|