C26H44O6 — CID 22828743
(3aS,4R,5R,6aS)-6a-hydroxy-5-(oxan-2-yloxy)-4-[(3S)-3-(oxan-2-yloxy)octyl]-1,3,3a,4,5,6-hexahydropentalen-2-one (PubChem CID 22828743) has the molecular formula C26H44O6 and a molecular weight of 452.63 g/mol. Its IUPAC name is (3aS,4R,5R,6aS)-6a-hydroxy-5-(oxan-2-yloxy)-4-[(3S)-3-(oxan-2-yloxy)octyl]-1,3,3a,4,5,6-hexahydropentalen-2-one.
| Compound Name | (3aS,4R,5R,6aS)-6a-hydroxy-5-(oxan-2-yloxy)-4-[(3S)-3-(oxan-2-yloxy)octyl]-1,3,3a,4,5,6-hexahydropentalen-2-one |
|---|---|
| PubChem CID | 22828743 |
| Molecular Formula | C26H44O6 |
| Molecular Weight | 452.63 g/mol |
| Exact Mass | 452.31 |
| IUPAC Name | (3aS,4R,5R,6aS)-6a-hydroxy-5-(oxan-2-yloxy)-4-[(3S)-3-(oxan-2-yloxy)octyl]-1,3,3a,4,5,6-hexahydropentalen-2-one |
| SMILES | CCCCC[C@@H](CC[C@H]1[C@H](OC2CCCCO2)C[C@]2(O)CC(=O)C[C@@H]12)OC1CCCCO1 |
| InChI | InChI=1S/C26H44O6/c1-2-3-4-9-20(31-24-10-5-7-14-29-24)12-13-21-22-16-19(27)17-26(22,28)18-23(21)32-25-11-6-8-15-30-25/h20-25,28H,2-18H2,1H3/t20-,21+,22-,23+,24?,25?,26+/m0/s1 |
| InChIKey | JTPMNBZZRNNWLX-KZARFHJWSA-N |
| XLogP | 4.90 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|