C27H44O4 — CID 67769977
7-[(3aR,5S,6S,6aR)-5-hydroxy-6-(1-hydroxy-5,9-dimethyldeca-1,8-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]heptanoic acid (PubChem CID 67769977) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 7-[(3aR,5S,6S,6aR)-5-hydroxy-6-(1-hydroxy-5,9-dimethyldeca-1,8-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]heptanoic acid.
| Compound Name | 7-[(3aR,5S,6S,6aR)-5-hydroxy-6-(1-hydroxy-5,9-dimethyldeca-1,8-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 67769977 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 7-[(3aR,5S,6S,6aR)-5-hydroxy-6-(1-hydroxy-5,9-dimethyldeca-1,8-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]heptanoic acid |
| SMILES | CC(C)=CCCC(C)CCC=C(O)[C@H]1[C@@H]2CC(CCCCCCC(=O)O)=C[C@@H]2C[C@@H]1O |
| InChI | InChI=1S/C27H44O4/c1-19(2)10-8-11-20(3)12-9-14-24(28)27-23-17-21(16-22(23)18-25(27)29)13-6-4-5-7-15-26(30)31/h10,14,16,20,22-23,25,27-29H,4-9,11-13,15,17-18H2,1-3H3,(H,30,31)/t20?,22-,23-,25+,27-/m1/s1 |
| InChIKey | PBVYFWCDMNPABJ-HDFNIYLOSA-N |
| XLogP | 6.96 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|