C21H32O4 — CID 67769663
5-[(3aR,5S,6S,6aR)-5-hydroxy-6-(8-hydroxyocta-1,7-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid (PubChem CID 67769663) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 5-[(3aR,5S,6S,6aR)-5-hydroxy-6-(8-hydroxyocta-1,7-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid.
| Compound Name | 5-[(3aR,5S,6S,6aR)-5-hydroxy-6-(8-hydroxyocta-1,7-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 67769663 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 5-[(3aR,5S,6S,6aR)-5-hydroxy-6-(8-hydroxyocta-1,7-dienyl)-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCC1=C[C@@H]2C[C@H](O)[C@@H](C=CCCCCC=CO)[C@@H]2C1 |
| InChI | InChI=1S/C21H32O4/c22-12-8-4-2-1-3-5-10-18-19-14-16(9-6-7-11-21(24)25)13-17(19)15-20(18)23/h5,8,10,12-13,17-20,22-23H,1-4,6-7,9,11,14-15H2,(H,24,25)/t17-,18+,19-,20+/m1/s1 |
| InChIKey | XJGVHYFBVFJBOD-WCIQWLHISA-N |
| XLogP | 4.76 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|