C22H36O3 — CID 57259012
9-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]non-8-enal (PubChem CID 57259012) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 9-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]non-8-enal.
| Compound Name | 9-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]non-8-enal |
|---|---|
| PubChem CID | 57259012 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 9-[(1R,2R,3aR,6aR)-2-hydroxy-5-(5-hydroxypentyl)-1,2,3,3a,6,6a-hexahydropentalen-1-yl]non-8-enal |
| SMILES | O=CCCCCCCC=C[C@@H]1[C@@H]2CC(CCCCCO)=C[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C22H36O3/c23-13-9-5-3-1-2-4-8-12-20-21-16-18(11-7-6-10-14-24)15-19(21)17-22(20)25/h8,12-13,15,19-22,24-25H,1-7,9-11,14,16-17H2/t19-,20-,21-,22-/m1/s1 |
| InChIKey | RWHDMPHLVWXZMD-GXRSIYKFSA-N |
| XLogP | 4.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|