C21H34O3 — CID 70409447
(2R,3S,3aS,6aS)-3-[(Z,3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-(5-hydroxypentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol (PubChem CID 70409447) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is (2R,3S,3aS,6aS)-3-[(Z,3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-(5-hydroxypentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol.
| Compound Name | (2R,3S,3aS,6aS)-3-[(Z,3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-(5-hydroxypentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
|---|---|
| PubChem CID | 70409447 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | (2R,3S,3aS,6aS)-3-[(Z,3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-(5-hydroxypentyl)-1,2,3,3a,4,6a-hexahydropentalen-2-ol |
| SMILES | OCCCCCC1=C[C@H]2C[C@@H](O)[C@@H](/C=C\[C@@H](O)C3CCCC3)[C@H]2C1 |
| InChI | InChI=1S/C21H34O3/c22-11-5-1-2-6-15-12-17-14-21(24)18(19(17)13-15)9-10-20(23)16-7-3-4-8-16/h9-10,12,16-24H,1-8,11,13-14H2/b10-9-/t17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | OXQNTWIEGOIVDO-AGWWWCFWSA-N |
| XLogP | 3.59 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|