C20H32O2 — CID 162967072
(3R,3aR,4E,6S,8Z,12aR)-3,8-dimethyl-12-methylidene-5-propan-2-yl-1,2,3a,6,7,10,11,12a-octahydrocyclopenta[11]annulene-3,6-diol (PubChem CID 162967072) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (3R,3aR,4E,6S,8Z,12aR)-3,8-dimethyl-12-methylidene-5-propan-2-yl-1,2,3a,6,7,10,11,12a-octahydrocyclopenta[11]annulene-3,6-diol.
| Compound Name | (3R,3aR,4E,6S,8Z,12aR)-3,8-dimethyl-12-methylidene-5-propan-2-yl-1,2,3a,6,7,10,11,12a-octahydrocyclopenta[11]annulene-3,6-diol |
|---|---|
| PubChem CID | 162967072 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3R,3aR,4E,6S,8Z,12aR)-3,8-dimethyl-12-methylidene-5-propan-2-yl-1,2,3a,6,7,10,11,12a-octahydrocyclopenta[11]annulene-3,6-diol |
| SMILES | C=C1CC/C=C(/C)C[C@H](O)/C(C(C)C)=C/[C@@H]2[C@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C20H32O2/c1-13(2)17-12-18-16(9-10-20(18,5)22)15(4)8-6-7-14(3)11-19(17)21/h7,12-13,16,18-19,21-22H,4,6,8-11H2,1-3,5H3/b14-7-,17-12+/t16-,18+,19-,20+/m0/s1 |
| InChIKey | YMOPJGVZPYEQEV-DJSONJDZSA-N |
| XLogP | 4.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|