C23H29FO5 — CID 57046429
5-[(3aR,5S,6S,6aR)-6-[4-(4-fluorophenoxy)butanoyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid (PubChem CID 57046429) has the molecular formula C23H29FO5 and a molecular weight of 404.48 g/mol. Its IUPAC name is 5-[(3aR,5S,6S,6aR)-6-[4-(4-fluorophenoxy)butanoyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid.
| Compound Name | 5-[(3aR,5S,6S,6aR)-6-[4-(4-fluorophenoxy)butanoyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 57046429 |
| Molecular Formula | C23H29FO5 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 5-[(3aR,5S,6S,6aR)-6-[4-(4-fluorophenoxy)butanoyl]-5-hydroxy-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCC1=C[C@@H]2C[C@H](O)[C@@H](C(=O)CCCOc3ccc(F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H29FO5/c24-17-7-9-18(10-8-17)29-11-3-5-20(25)23-19-13-15(4-1-2-6-22(27)28)12-16(19)14-21(23)26/h7-10,12,16,19,21,23,26H,1-6,11,13-14H2,(H,27,28)/t16-,19-,21+,23-/m1/s1 |
| InChIKey | ULUUVPOBRUEMOU-GLBGETKPSA-N |
| XLogP | 4.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|