C22H31FO6 — CID 22828976
4-[[(3aR,4R,5R,6aS)-4-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanoic acid (PubChem CID 22828976) has the molecular formula C22H31FO6 and a molecular weight of 410.48 g/mol. Its IUPAC name is 4-[[(3aR,4R,5R,6aS)-4-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanoic acid.
| Compound Name | 4-[[(3aR,4R,5R,6aS)-4-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 22828976 |
| Molecular Formula | C22H31FO6 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 4-[[(3aR,4R,5R,6aS)-4-[4-(4-fluorophenoxy)-3-hydroxybutyl]-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]oxy]butanoic acid |
| SMILES | O=C(O)CCCOC1C[C@@H]2C[C@@H](O)[C@H](CCC(O)COc3ccc(F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C22H31FO6/c23-15-3-6-17(7-4-15)29-13-16(24)5-8-19-20-12-18(10-14(20)11-21(19)25)28-9-1-2-22(26)27/h3-4,6-7,14,16,18-21,24-25H,1-2,5,8-13H2,(H,26,27)/t14-,16?,18?,19-,20-,21-/m1/s1 |
| InChIKey | WUHZOFHPCBPVFQ-QEIKXJNYSA-N |
| XLogP | 3.00 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|