C22H29FO5S — CID 57027283
8-[2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-5-oxocyclopent-3-en-1-yl]octanoic acid (PubChem CID 57027283) has the molecular formula C22H29FO5S and a molecular weight of 424.53 g/mol. Its IUPAC name is 8-[2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-5-oxocyclopent-3-en-1-yl]octanoic acid.
| Compound Name | 8-[2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-5-oxocyclopent-3-en-1-yl]octanoic acid |
|---|---|
| PubChem CID | 57027283 |
| Molecular Formula | C22H29FO5S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 8-[2-[3-(4-fluorophenoxy)-2-hydroxypropyl]sulfanyl-5-oxocyclopent-3-en-1-yl]octanoic acid |
| SMILES | O=C(O)CCCCCCCC1C(=O)C=CC1SCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C22H29FO5S/c23-16-8-10-18(11-9-16)28-14-17(24)15-29-21-13-12-20(25)19(21)6-4-2-1-3-5-7-22(26)27/h8-13,17,19,21,24H,1-7,14-15H2,(H,26,27) |
| InChIKey | JQLWRENSFYTZTC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|