C20H29ClO6S — CID 57072215
6-[2-[3-(3-chlorophenoxy)-2-hydroxypropyl]sulfanyl-3,5-dihydroxycyclopentyl]hexanoic acid (PubChem CID 57072215) has the molecular formula C20H29ClO6S and a molecular weight of 432.97 g/mol. Its IUPAC name is 6-[2-[3-(3-chlorophenoxy)-2-hydroxypropyl]sulfanyl-3,5-dihydroxycyclopentyl]hexanoic acid.
| Compound Name | 6-[2-[3-(3-chlorophenoxy)-2-hydroxypropyl]sulfanyl-3,5-dihydroxycyclopentyl]hexanoic acid |
|---|---|
| PubChem CID | 57072215 |
| Molecular Formula | C20H29ClO6S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 6-[2-[3-(3-chlorophenoxy)-2-hydroxypropyl]sulfanyl-3,5-dihydroxycyclopentyl]hexanoic acid |
| SMILES | O=C(O)CCCCCC1C(O)CC(O)C1SCC(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H29ClO6S/c21-13-5-4-6-15(9-13)27-11-14(22)12-28-20-16(17(23)10-18(20)24)7-2-1-3-8-19(25)26/h4-6,9,14,16-18,20,22-24H,1-3,7-8,10-12H2,(H,25,26) |
| InChIKey | UPFSUUDGVQWXKS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|