C22H31ClO6 — CID 177175760
1-(3-chlorophenoxy)but-3-en-2-ol;(Z)-7-(2,4-dihydroxycyclopentyl)hept-5-enoic acid (PubChem CID 177175760) has the molecular formula C22H31ClO6 and a molecular weight of 426.94 g/mol. Its IUPAC name is 1-(3-chlorophenoxy)but-3-en-2-ol;(Z)-7-(2,4-dihydroxycyclopentyl)hept-5-enoic acid.
| Compound Name | 1-(3-chlorophenoxy)but-3-en-2-ol;(Z)-7-(2,4-dihydroxycyclopentyl)hept-5-enoic acid |
|---|---|
| PubChem CID | 177175760 |
| Molecular Formula | C22H31ClO6 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-(3-chlorophenoxy)but-3-en-2-ol;(Z)-7-(2,4-dihydroxycyclopentyl)hept-5-enoic acid |
| SMILES | C=CC(O)COc1cccc(Cl)c1.O=C(O)CCC/C=C\CC1CC(O)CC1O |
| InChI | InChI=1S/C12H20O4.C10H11ClO2/c13-10-7-9(11(14)8-10)5-3-1-2-4-6-12(15)16;1-2-9(12)7-13-10-5-3-4-8(11)6-10/h1,3,9-11,13-14H,2,4-8H2,(H,15,16);2-6,9,12H,1,7H2/b3-1-; |
| InChIKey | SNPJEGKPZXMWMJ-SPNQZIMRSA-N |
| XLogP | 3.59 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|