C26H40ClNO5 — CID 58090963
7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]-N-(cyclopropylmethyl)heptanamide (PubChem CID 58090963) has the molecular formula C26H40ClNO5 and a molecular weight of 482.06 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]-N-(cyclopropylmethyl)heptanamide.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]-N-(cyclopropylmethyl)heptanamide |
|---|---|
| PubChem CID | 58090963 |
| Molecular Formula | C26H40ClNO5 |
| Molecular Weight | 482.06 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybutyl]-3,5-dihydroxycyclopentyl]-N-(cyclopropylmethyl)heptanamide |
| SMILES | O=C(CCCCCC[C@@H]1[C@@H](CC[C@@H](O)COc2cccc(Cl)c2)[C@H](O)C[C@@H]1O)NCC1CC1 |
| InChI | InChI=1S/C26H40ClNO5/c27-19-6-5-7-21(14-19)33-17-20(29)12-13-23-22(24(30)15-25(23)31)8-3-1-2-4-9-26(32)28-16-18-10-11-18/h5-7,14,18,20,22-25,29-31H,1-4,8-13,15-17H2,(H,28,32)/t20-,22-,23-,24+,25-/m1/s1 |
| InChIKey | QHMCOIXUQVZOSD-OYHORMKUSA-N |
| XLogP | 4.08 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.06 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|