C26H37NO4 — CID 58090977
N-(cyclopropylmethyl)-7-[2-[(3R)-3-hydroxy-4-phenoxybutyl]-5-oxocyclopenten-1-yl]heptanamide (PubChem CID 58090977) has the molecular formula C26H37NO4 and a molecular weight of 427.59 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-7-[2-[(3R)-3-hydroxy-4-phenoxybutyl]-5-oxocyclopenten-1-yl]heptanamide.
| Compound Name | N-(cyclopropylmethyl)-7-[2-[(3R)-3-hydroxy-4-phenoxybutyl]-5-oxocyclopenten-1-yl]heptanamide |
|---|---|
| PubChem CID | 58090977 |
| Molecular Formula | C26H37NO4 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | N-(cyclopropylmethyl)-7-[2-[(3R)-3-hydroxy-4-phenoxybutyl]-5-oxocyclopenten-1-yl]heptanamide |
| SMILES | O=C(CCCCCCC1=C(CC[C@@H](O)COc2ccccc2)CCC1=O)NCC1CC1 |
| InChI | InChI=1S/C26H37NO4/c28-22(19-31-23-8-4-3-5-9-23)16-14-21-15-17-25(29)24(21)10-6-1-2-7-11-26(30)27-18-20-12-13-20/h3-5,8-9,20,22,28H,1-2,6-7,10-19H2,(H,27,30)/t22-/m1/s1 |
| InChIKey | PXTYNATYTOVJIK-JOCHJYFZSA-N |
| XLogP | 4.73 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|