C30H48ClNO5 — CID 91560794
8-[2-[6-(3-chlorophenoxy)-5-hydroxyhexan-2-yl]-3,5-dihydroxycyclopentyl]-N-(cyclopropylmethyl)-7-methyloctanamide (PubChem CID 91560794) has the molecular formula C30H48ClNO5 and a molecular weight of 538.17 g/mol. Its IUPAC name is 8-[2-[6-(3-chlorophenoxy)-5-hydroxyhexan-2-yl]-3,5-dihydroxycyclopentyl]-N-(cyclopropylmethyl)-7-methyloctanamide.
| Compound Name | 8-[2-[6-(3-chlorophenoxy)-5-hydroxyhexan-2-yl]-3,5-dihydroxycyclopentyl]-N-(cyclopropylmethyl)-7-methyloctanamide |
|---|---|
| PubChem CID | 91560794 |
| Molecular Formula | C30H48ClNO5 |
| Molecular Weight | 538.17 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 8-[2-[6-(3-chlorophenoxy)-5-hydroxyhexan-2-yl]-3,5-dihydroxycyclopentyl]-N-(cyclopropylmethyl)-7-methyloctanamide |
| SMILES | CC(CCCCCC(=O)NCC1CC1)CC1C(O)CC(O)C1C(C)CCC(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C30H48ClNO5/c1-20(7-4-3-5-10-29(36)32-18-22-12-13-22)15-26-27(34)17-28(35)30(26)21(2)11-14-24(33)19-37-25-9-6-8-23(31)16-25/h6,8-9,16,20-22,24,26-28,30,33-35H,3-5,7,10-15,17-19H2,1-2H3,(H,32,36) |
| InChIKey | MXZXILWXZXGGLN-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.17 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|