C25H35F3O6 — CID 146531073
methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(4R)-4-hydroxy-5-[3-(trifluoromethyl)phenoxy]pentan-2-yl]cyclopentyl]hept-5-enoate (PubChem CID 146531073) has the molecular formula C25H35F3O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(4R)-4-hydroxy-5-[3-(trifluoromethyl)phenoxy]pentan-2-yl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(4R)-4-hydroxy-5-[3-(trifluoromethyl)phenoxy]pentan-2-yl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 146531073 |
| Molecular Formula | C25H35F3O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | methyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(4R)-4-hydroxy-5-[3-(trifluoromethyl)phenoxy]pentan-2-yl]cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](C(C)C[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H35F3O6/c1-16(12-18(29)15-34-19-9-7-8-17(13-19)25(26,27)28)24-20(21(30)14-22(24)31)10-5-3-4-6-11-23(32)33-2/h3,5,7-9,13,16,18,20-22,24,29-31H,4,6,10-12,14-15H2,1-2H3/b5-3-/t16?,18-,20+,21+,22-,24-/m1/s1 |
| InChIKey | QIRPLVBPXDPDDV-YHXKHTKSSA-N |
| XLogP | 4.12 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|