C22H31F3O4S — CID 59930514
(4S)-4-[(Z)-hept-2-enyl]-5-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]sulfanylcyclopentane-1,3-diol (PubChem CID 59930514) has the molecular formula C22H31F3O4S and a molecular weight of 448.55 g/mol. Its IUPAC name is (4S)-4-[(Z)-hept-2-enyl]-5-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]sulfanylcyclopentane-1,3-diol.
| Compound Name | (4S)-4-[(Z)-hept-2-enyl]-5-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]sulfanylcyclopentane-1,3-diol |
|---|---|
| PubChem CID | 59930514 |
| Molecular Formula | C22H31F3O4S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (4S)-4-[(Z)-hept-2-enyl]-5-[2-hydroxy-3-[3-(trifluoromethyl)phenoxy]propyl]sulfanylcyclopentane-1,3-diol |
| SMILES | CCCC/C=C\C[C@H]1C(O)CC(O)C1SCC(O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H31F3O4S/c1-2-3-4-5-6-10-18-19(27)12-20(28)21(18)30-14-16(26)13-29-17-9-7-8-15(11-17)22(23,24)25/h5-9,11,16,18-21,26-28H,2-4,10,12-14H2,1H3/b6-5-/t16?,18-,19?,20?,21?/m0/s1 |
| InChIKey | JOYJLGAISSLBIS-HHQQGFFWSA-N |
| XLogP | 4.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|