C24H33F3O2 — CID 90828182
3-[(Z)-hept-2-enyl]-2-[(E)-3-methyl-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentan-1-ol (PubChem CID 90828182) has the molecular formula C24H33F3O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[(Z)-hept-2-enyl]-2-[(E)-3-methyl-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentan-1-ol.
| Compound Name | 3-[(Z)-hept-2-enyl]-2-[(E)-3-methyl-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 90828182 |
| Molecular Formula | C24H33F3O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 3-[(Z)-hept-2-enyl]-2-[(E)-3-methyl-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentan-1-ol |
| SMILES | CCCC/C=C\CC1CCC(O)C1/C=C/C(C)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H33F3O2/c1-3-4-5-6-7-9-19-13-15-23(28)22(19)14-12-18(2)17-29-21-11-8-10-20(16-21)24(25,26)27/h6-8,10-12,14,16,18-19,22-23,28H,3-5,9,13,15,17H2,1-2H3/b7-6-,14-12+ |
| InChIKey | KUWIEJCOTLNBGN-UCTGSFMMSA-N |
| XLogP | 6.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|