C29H41F3N2O11 — CID 143078461
[3-nitrooxy-2-(2-nitrooxyethoxy)propyl] formate;trans-(1R,3R)-3-[(Z)-hept-2-enyl]-2-[(E)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentan-1-ol (PubChem CID 143078461) has the molecular formula C29H41F3N2O11 and a molecular weight of 650.64 g/mol. Its IUPAC name is [3-nitrooxy-2-(2-nitrooxyethoxy)propyl] formate;trans-(1R,3R)-3-[(Z)-hept-2-enyl]-2-[(E)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentan-1-ol.
| Compound Name | [3-nitrooxy-2-(2-nitrooxyethoxy)propyl] formate;trans-(1R,3R)-3-[(Z)-hept-2-enyl]-2-[(E)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 143078461 |
| Molecular Formula | C29H41F3N2O11 |
| Molecular Weight | 650.64 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | [3-nitrooxy-2-(2-nitrooxyethoxy)propyl] formate;trans-(1R,3R)-3-[(Z)-hept-2-enyl]-2-[(E)-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentan-1-ol |
| SMILES | CCCC/C=C\C[C@H]1CC[C@@H](O)C1/C=C/CCOc1cccc(C(F)(F)F)c1.O=COCC(CO[N+](=O)[O-])OCCO[N+](=O)[O-] |
| InChI | InChI=1S/C23H31F3O2.C6H10N2O9/c1-2-3-4-5-6-10-18-14-15-22(27)21(18)13-7-8-16-28-20-12-9-11-19(17-20)23(24,25)26;9-5-14-3-6(4-17-8(12)13)15-1-2-16-7(10)11/h5-7,9,11-13,17-18,21-22,27H,2-4,8,10,14-16H2,1H3;5-6H,1-4H2/b6-5-,13-7+;/t18-,21?,22+;/m0./s1 |
| InChIKey | VMMLKALDEDCINE-ICIYGVFNSA-N |
| XLogP | 5.52 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|