C34H43F3N2O7 — CID 143381327
1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[3-(nitrooxymethyl)phenyl] 2-[[(Z)-oct-5-enoyl]amino]propanoate (PubChem CID 143381327) has the molecular formula C34H43F3N2O7 and a molecular weight of 648.72 g/mol. Its IUPAC name is 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[3-(nitrooxymethyl)phenyl] 2-[[(Z)-oct-5-enoyl]amino]propanoate.
| Compound Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[3-(nitrooxymethyl)phenyl] 2-[[(Z)-oct-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 143381327 |
| Molecular Formula | C34H43F3N2O7 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.30 |
| IUPAC Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[3-(nitrooxymethyl)phenyl] 2-[[(Z)-oct-5-enoyl]amino]propanoate |
| SMILES | CC/C=C\CCCC(=O)NC(C)C(=O)Oc1cccc(CO[N+](=O)[O-])c1.FC(F)(F)c1cccc(OCC/C=C/C2CCCC2)c1 |
| InChI | InChI=1S/C18H24N2O6.C16H19F3O/c1-3-4-5-6-7-11-17(21)19-14(2)18(22)26-16-10-8-9-15(12-16)13-25-20(23)24;17-16(18,19)14-9-5-10-15(12-14)20-11-4-3-8-13-6-1-2-7-13/h4-5,8-10,12,14H,3,6-7,11,13H2,1-2H3,(H,19,21);3,5,8-10,12-13H,1-2,4,6-7,11H2/b5-4-;8-3+ |
| InChIKey | GPHZJIGAAVCBRF-UOBUWXIRSA-N |
| XLogP | 8.16 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|