C35H56F3N3O5 — CID 143381193
1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-[1-(3-formamidopropyl)piperidin-4-yl]propyl nitrate;(Z)-hept-2-ene (PubChem CID 143381193) has the molecular formula C35H56F3N3O5 and a molecular weight of 655.84 g/mol. Its IUPAC name is 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-[1-(3-formamidopropyl)piperidin-4-yl]propyl nitrate;(Z)-hept-2-ene.
| Compound Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-[1-(3-formamidopropyl)piperidin-4-yl]propyl nitrate;(Z)-hept-2-ene |
|---|---|
| PubChem CID | 143381193 |
| Molecular Formula | C35H56F3N3O5 |
| Molecular Weight | 655.84 g/mol |
| Exact Mass | 655.42 |
| IUPAC Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;3-[1-(3-formamidopropyl)piperidin-4-yl]propyl nitrate;(Z)-hept-2-ene |
| SMILES | C/C=C\CCCC.FC(F)(F)c1cccc(OCC/C=C/C2CCCC2)c1.O=CNCCCN1CCC(CCCO[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H19F3O.C12H23N3O4.C7H14/c17-16(18,19)14-9-5-10-15(12-14)20-11-4-3-8-13-6-1-2-7-13;16-11-13-6-2-7-14-8-4-12(5-9-14)3-1-10-19-15(17)18;1-3-5-7-6-4-2/h3,5,8-10,12-13H,1-2,4,6-7,11H2;11-12H,1-10H2,(H,13,16);3,5H,4,6-7H2,1-2H3/b8-3+;;5-3- |
| InChIKey | IWJZUCACWPVIBA-SZENVYGZSA-N |
| XLogP | 8.80 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.84 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|