C33H49F3N2O8S — CID 143078553
S-(2-acetamidopropyl) (Z)-hept-5-enethioate;1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;4-nitrooxybutyl formate (PubChem CID 143078553) has the molecular formula C33H49F3N2O8S and a molecular weight of 690.82 g/mol. Its IUPAC name is S-(2-acetamidopropyl) (Z)-hept-5-enethioate;1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;4-nitrooxybutyl formate.
| Compound Name | S-(2-acetamidopropyl) (Z)-hept-5-enethioate;1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;4-nitrooxybutyl formate |
|---|---|
| PubChem CID | 143078553 |
| Molecular Formula | C33H49F3N2O8S |
| Molecular Weight | 690.82 g/mol |
| Exact Mass | 690.32 |
| IUPAC Name | S-(2-acetamidopropyl) (Z)-hept-5-enethioate;1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;4-nitrooxybutyl formate |
| SMILES | C/C=C\CCCC(=O)SCC(C)NC(C)=O.FC(F)(F)c1cccc(OCC/C=C/C2CCCC2)c1.O=COCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C16H19F3O.C12H21NO2S.C5H9NO5/c17-16(18,19)14-9-5-10-15(12-14)20-11-4-3-8-13-6-1-2-7-13;1-4-5-6-7-8-12(15)16-9-10(2)13-11(3)14;7-5-10-3-1-2-4-11-6(8)9/h3,5,8-10,12-13H,1-2,4,6-7,11H2;4-5,10H,6-9H2,1-3H3,(H,13,14);5H,1-4H2/b8-3+;5-4-; |
| InChIKey | GQMWYEJEBQBSCD-SQUPVQCOSA-N |
| XLogP | 7.89 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.82 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|