C30H41F3N2O10 — CID 143078506
1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[3-nitrooxy-2-(4-nitrosooxybutanoyloxy)propyl] (Z)-hept-5-enoate (PubChem CID 143078506) has the molecular formula C30H41F3N2O10 and a molecular weight of 646.66 g/mol. Its IUPAC name is 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[3-nitrooxy-2-(4-nitrosooxybutanoyloxy)propyl] (Z)-hept-5-enoate.
| Compound Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[3-nitrooxy-2-(4-nitrosooxybutanoyloxy)propyl] (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 143078506 |
| Molecular Formula | C30H41F3N2O10 |
| Molecular Weight | 646.66 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | 1-[(E)-4-cyclopentylbut-3-enoxy]-3-(trifluoromethyl)benzene;[3-nitrooxy-2-(4-nitrosooxybutanoyloxy)propyl] (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OCC(CO[N+](=O)[O-])OC(=O)CCCON=O.FC(F)(F)c1cccc(OCC/C=C/C2CCCC2)c1 |
| InChI | InChI=1S/C16H19F3O.C14H22N2O9/c17-16(18,19)14-9-5-10-15(12-14)20-11-4-3-8-13-6-1-2-7-13;1-2-3-4-5-7-13(17)22-10-12(11-24-16(20)21)25-14(18)8-6-9-23-15-19/h3,5,8-10,12-13H,1-2,4,6-7,11H2;2-3,12H,4-11H2,1H3/b8-3+;3-2- |
| InChIKey | PJYMLKBLOXSGPK-AATQBVRTSA-N |
| XLogP | 7.09 |
| TPSA | 152.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.66 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|