C14H22N2O10 — CID 143381556
[3-nitrooxy-2-(4-nitrooxybutanoyloxy)propyl] (Z)-hept-5-enoate (PubChem CID 143381556) has the molecular formula C14H22N2O10 and a molecular weight of 378.33 g/mol. Its IUPAC name is [3-nitrooxy-2-(4-nitrooxybutanoyloxy)propyl] (Z)-hept-5-enoate.
| Compound Name | [3-nitrooxy-2-(4-nitrooxybutanoyloxy)propyl] (Z)-hept-5-enoate |
|---|---|
| PubChem CID | 143381556 |
| Molecular Formula | C14H22N2O10 |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | [3-nitrooxy-2-(4-nitrooxybutanoyloxy)propyl] (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OCC(CO[N+](=O)[O-])OC(=O)CCCO[N+](=O)[O-] |
| InChI | InChI=1S/C14H22N2O10/c1-2-3-4-5-7-13(17)23-10-12(11-25-16(21)22)26-14(18)8-6-9-24-15(19)20/h2-3,12H,4-11H2,1H3/b3-2- |
| InChIKey | LXFKDDGPTYGECO-IHWYPQMZSA-N |
| XLogP | 1.38 |
| TPSA | 157.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|