C35H61NO6 — CID 144929453
[2-[(E)-10-aminodec-9-enoyl]oxy-3-[(E)-undec-9-enoyl]oxypropyl] (Z)-undec-9-enoate (PubChem CID 144929453) has the molecular formula C35H61NO6 and a molecular weight of 591.87 g/mol. Its IUPAC name is [2-[(E)-10-aminodec-9-enoyl]oxy-3-[(E)-undec-9-enoyl]oxypropyl] (Z)-undec-9-enoate.
| Compound Name | [2-[(E)-10-aminodec-9-enoyl]oxy-3-[(E)-undec-9-enoyl]oxypropyl] (Z)-undec-9-enoate |
|---|---|
| PubChem CID | 144929453 |
| Molecular Formula | C35H61NO6 |
| Molecular Weight | 591.87 g/mol |
| Exact Mass | 591.45 |
| IUPAC Name | [2-[(E)-10-aminodec-9-enoyl]oxy-3-[(E)-undec-9-enoyl]oxypropyl] (Z)-undec-9-enoate |
| SMILES | C/C=C\CCCCCCCC(=O)OCC(COC(=O)CCCCCCC/C=C/C)OC(=O)CCCCCCC/C=C/N |
| InChI | InChI=1S/C35H61NO6/c1-3-5-7-9-11-14-18-22-26-33(37)40-30-32(42-35(39)28-24-20-16-13-17-21-25-29-36)31-41-34(38)27-23-19-15-12-10-8-6-4-2/h3-6,25,29,32H,7-24,26-28,30-31,36H2,1-2H3/b5-3-,6-4+,29-25+ |
| InChIKey | IOABZMBATFAQOJ-NWKXMDRMSA-N |
| XLogP | 8.80 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.87 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|