C26H39ClN2O6 — CID 143381133
1-chloro-3-[(E)-4-cyclopentylbut-3-enoxy]benzene;2-[2-[[(Z)-hept-5-enoyl]amino]ethoxy]ethyl nitrate (PubChem CID 143381133) has the molecular formula C26H39ClN2O6 and a molecular weight of 511.06 g/mol. Its IUPAC name is 1-chloro-3-[(E)-4-cyclopentylbut-3-enoxy]benzene;2-[2-[[(Z)-hept-5-enoyl]amino]ethoxy]ethyl nitrate.
| Compound Name | 1-chloro-3-[(E)-4-cyclopentylbut-3-enoxy]benzene;2-[2-[[(Z)-hept-5-enoyl]amino]ethoxy]ethyl nitrate |
|---|---|
| PubChem CID | 143381133 |
| Molecular Formula | C26H39ClN2O6 |
| Molecular Weight | 511.06 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 1-chloro-3-[(E)-4-cyclopentylbut-3-enoxy]benzene;2-[2-[[(Z)-hept-5-enoyl]amino]ethoxy]ethyl nitrate |
| SMILES | C/C=C\CCCC(=O)NCCOCCO[N+](=O)[O-].Clc1cccc(OCC/C=C/C2CCCC2)c1 |
| InChI | InChI=1S/C15H19ClO.C11H20N2O5/c16-14-9-5-10-15(12-14)17-11-4-3-8-13-6-1-2-7-13;1-2-3-4-5-6-11(14)12-7-8-17-9-10-18-13(15)16/h3,5,8-10,12-13H,1-2,4,6-7,11H2;2-3H,4-10H2,1H3,(H,12,14)/b8-3+;3-2- |
| InChIKey | OPPKWQPROSCKDI-AATQBVRTSA-N |
| XLogP | 5.93 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.06 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|