C27H44N2O5 — CID 143381122
5-cyclopentylpentylbenzene;2-[2-[[(Z)-hept-5-enoyl]amino]ethoxy]ethyl nitrate (PubChem CID 143381122) has the molecular formula C27H44N2O5 and a molecular weight of 476.66 g/mol. Its IUPAC name is 5-cyclopentylpentylbenzene;2-[2-[[(Z)-hept-5-enoyl]amino]ethoxy]ethyl nitrate.
| Compound Name | 5-cyclopentylpentylbenzene;2-[2-[[(Z)-hept-5-enoyl]amino]ethoxy]ethyl nitrate |
|---|---|
| PubChem CID | 143381122 |
| Molecular Formula | C27H44N2O5 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.33 |
| IUPAC Name | 5-cyclopentylpentylbenzene;2-[2-[[(Z)-hept-5-enoyl]amino]ethoxy]ethyl nitrate |
| SMILES | C/C=C\CCCC(=O)NCCOCCO[N+](=O)[O-].c1ccc(CCCCCC2CCCC2)cc1 |
| InChI | InChI=1S/C16H24.C11H20N2O5/c1-3-9-15(10-4-1)11-5-2-6-12-16-13-7-8-14-16;1-2-3-4-5-6-11(14)12-7-8-17-9-10-18-13(15)16/h1,3-4,9-10,16H,2,5-8,11-14H2;2-3H,4-10H2,1H3,(H,12,14)/b;3-2- |
| InChIKey | ZXXZLMLWOZNBGM-AHNKWOMYSA-N |
| XLogP | 6.05 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|