C9H16N2O4 — CID 143381490
2-[[(Z)-hept-5-enoyl]amino]ethyl nitrate (PubChem CID 143381490) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-[[(Z)-hept-5-enoyl]amino]ethyl nitrate.
| Compound Name | 2-[[(Z)-hept-5-enoyl]amino]ethyl nitrate |
|---|---|
| PubChem CID | 143381490 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-[[(Z)-hept-5-enoyl]amino]ethyl nitrate |
| SMILES | C/C=C\CCCC(=O)NCCO[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N2O4/c1-2-3-4-5-6-9(12)10-7-8-15-11(13)14/h2-3H,4-8H2,1H3,(H,10,12)/b3-2- |
| InChIKey | OBCJWQZLQZSCSU-IHWYPQMZSA-N |
| XLogP | 1.06 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|